C18H24BN3O2S — CID 168619391
4-methyl-N-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 168619391) has the molecular formula C18H24BN3O2S and a molecular weight of 357.29 g/mol. Its IUPAC name is 4-methyl-N-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619391 |
| Molecular Formula | C18H24BN3O2S |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-methyl-N-[[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccc(B3OC(C)(C)C(C)(C)O3)c(C)c2)n1 |
| InChI | InChI=1S/C18H24BN3O2S/c1-12-9-14(10-20-22-16-21-13(2)11-25-16)7-8-15(12)19-23-17(3,4)18(5,6)24-19/h7-11H,1-6H3,(H,21,22) |
| InChIKey | RLVHTFBSPOUFTJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|