C22H30BN3O6S — CID 168623792
ethyl 2-[2-[2-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate (PubChem CID 168623792) has the molecular formula C22H30BN3O6S and a molecular weight of 475.38 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 168623792 |
| Molecular Formula | C22H30BN3O6S |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | ethyl 2-[2-[2-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]hydrazinyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2c(OC)cc(OC)cc2B2OC(C)(C)C(C)(C)O2)n1 |
| InChI | InChI=1S/C22H30BN3O6S/c1-8-30-19(27)9-14-13-33-20(25-14)26-24-12-16-17(10-15(28-6)11-18(16)29-7)23-31-21(2,3)22(4,5)32-23/h10-13H,8-9H2,1-7H3,(H,25,26) |
| InChIKey | HVGOEPMSRSJSEJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|