C18H25BN4O4S — CID 168626735
2-N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626735) has the molecular formula C18H25BN4O4S and a molecular weight of 404.30 g/mol. Its IUPAC name is 2-N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626735 |
| Molecular Formula | C18H25BN4O4S |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-N-[[2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(OC)c(C=NNc2nc(N)cs2)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C18H25BN4O4S/c1-17(2)18(3,4)27-19(26-17)13-7-11(24-5)8-14(25-6)12(13)9-21-23-16-22-15(20)10-28-16/h7-10H,20H2,1-6H3,(H,22,23) |
| InChIKey | HWVOWVBSJJILLR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|