C11H10ClFN4OS — CID 168625862
2-N-[(2-chloro-6-fluoro-3-methoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168625862) has the molecular formula C11H10ClFN4OS and a molecular weight of 300.75 g/mol. Its IUPAC name is 2-N-[(2-chloro-6-fluoro-3-methoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(2-chloro-6-fluoro-3-methoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168625862 |
| Molecular Formula | C11H10ClFN4OS |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-N-[(2-chloro-6-fluoro-3-methoxyphenyl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | COc1ccc(F)c(C=NNc2nc(N)cs2)c1Cl |
| InChI | InChI=1S/C11H10ClFN4OS/c1-18-8-3-2-7(13)6(10(8)12)4-15-17-11-16-9(14)5-19-11/h2-5H,14H2,1H3,(H,16,17) |
| InChIKey | JZHVNYCUVJYBES-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|