C18H17ClN4O2S — CID 168626534
2-N-[[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626534) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is 2-N-[[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626534 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-N-[[3-[(3-chlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | COc1ccc(C=NNc2nc(N)cs2)cc1COc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN4O2S/c1-24-16-6-5-12(9-21-23-18-22-17(20)11-26-18)7-13(16)10-25-15-4-2-3-14(19)8-15/h2-9,11H,10,20H2,1H3,(H,22,23) |
| InChIKey | VEDYDHDSJJFESV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|