C13H16BN3O4S — CID 168619326
[2,6-dimethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 168619326) has the molecular formula C13H16BN3O4S and a molecular weight of 321.17 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [2,6-dimethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 168619326 |
| Molecular Formula | C13H16BN3O4S |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | [2,6-dimethoxy-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | COc1cc(C=NNc2nc(C)cs2)cc(OC)c1B(O)O |
| InChI | InChI=1S/C13H16BN3O4S/c1-8-7-22-13(16-8)17-15-6-9-4-10(20-2)12(14(18)19)11(5-9)21-3/h4-7,18-19H,1-3H3,(H,16,17) |
| InChIKey | YMVYOKXTWDJDDQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|