C14H12FN3OS — CID 168619192
N-[(3-ethynyl-5-fluoro-4-methoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168619192) has the molecular formula C14H12FN3OS and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[(3-ethynyl-5-fluoro-4-methoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(3-ethynyl-5-fluoro-4-methoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168619192 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[(3-ethynyl-5-fluoro-4-methoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | C#Cc1cc(C=NNc2nc(C)cs2)cc(F)c1OC |
| InChI | InChI=1S/C14H12FN3OS/c1-4-11-5-10(6-12(15)13(11)19-3)7-16-18-14-17-9(2)8-20-14/h1,5-8H,2-3H3,(H,17,18) |
| InChIKey | TUNHXMWFNJZVJB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|