C15H24BNO2S — CID 171191246
(R)-(4-ethylsulfanylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine (PubChem CID 171191246) has the molecular formula C15H24BNO2S and a molecular weight of 293.24 g/mol. Its IUPAC name is (R)-(4-ethylsulfanylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine.
| Compound Name | (R)-(4-ethylsulfanylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
|---|---|
| PubChem CID | 171191246 |
| Molecular Formula | C15H24BNO2S |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (R)-(4-ethylsulfanylphenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanamine |
| SMILES | CCSc1ccc([C@H](N)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H24BNO2S/c1-6-20-12-9-7-11(8-10-12)13(17)16-18-14(2,3)15(4,5)19-16/h7-10,13H,6,17H2,1-5H3/t13-/m0/s1 |
| InChIKey | KZOVDSIJTAXTQO-ZDUSSCGKSA-N |
| XLogP | 3.43 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|