C17H29BN2O2 — CID 171191103
4-[(R)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-diethylaniline (PubChem CID 171191103) has the molecular formula C17H29BN2O2 and a molecular weight of 304.24 g/mol. Its IUPAC name is 4-[(R)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-diethylaniline.
| Compound Name | 4-[(R)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 171191103 |
| Molecular Formula | C17H29BN2O2 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 4-[(R)-amino-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc([C@H](N)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H29BN2O2/c1-7-20(8-2)14-11-9-13(10-12-14)15(19)18-21-16(3,4)17(5,6)22-18/h9-12,15H,7-8,19H2,1-6H3/t15-/m0/s1 |
| InChIKey | PXPDHSKQQSWMIX-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|