C29H26O5 — CID 11091687
(1E,6E)-1,7-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione (PubChem CID 11091687) has the molecular formula C29H26O5 and a molecular weight of 454.52 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 11091687 |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (1E,6E)-1,7-bis(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(C=C(C(=O)/C=C/c2ccc(OC)cc2)C(=O)/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H26O5/c1-32-24-12-4-21(5-13-24)10-18-28(30)27(20-23-8-16-26(34-3)17-9-23)29(31)19-11-22-6-14-25(33-2)15-7-22/h4-20H,1-3H3/b18-10+,19-11+ |
| InChIKey | WXCJULJGACPZLY-XOBNHNQQSA-N |
| XLogP | 5.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|