C23H24O6S — CID 57249542
7-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-3-methylsulfonylhept-6-ene-2,5-dione (PubChem CID 57249542) has the molecular formula C23H24O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-3-methylsulfonylhept-6-ene-2,5-dione.
| Compound Name | 7-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-3-methylsulfonylhept-6-ene-2,5-dione |
|---|---|
| PubChem CID | 57249542 |
| Molecular Formula | C23H24O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 7-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylidene]-3-methylsulfonylhept-6-ene-2,5-dione |
| SMILES | COc1ccc(C=CC(=O)C(=Cc2ccc(OC)cc2)C(C(C)=O)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H24O6S/c1-16(24)23(30(4,26)27)21(15-18-7-12-20(29-3)13-8-18)22(25)14-9-17-5-10-19(28-2)11-6-17/h5-15,23H,1-4H3 |
| InChIKey | CWUWAESUWSDNNG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|