C19H18F2O3 — CID 162419475
1-[(Z)-1-(1,1-difluoroprop-2-enoxy)-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene (PubChem CID 162419475) has the molecular formula C19H18F2O3 and a molecular weight of 332.35 g/mol. Its IUPAC name is 1-[(Z)-1-(1,1-difluoroprop-2-enoxy)-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene.
| Compound Name | 1-[(Z)-1-(1,1-difluoroprop-2-enoxy)-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 162419475 |
| Molecular Formula | C19H18F2O3 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[(Z)-1-(1,1-difluoroprop-2-enoxy)-2-(4-methoxyphenyl)ethenyl]-4-methoxybenzene |
| SMILES | C=CC(F)(F)O/C(=C\c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H18F2O3/c1-4-19(20,21)24-18(15-7-11-17(23-3)12-8-15)13-14-5-9-16(22-2)10-6-14/h4-13H,1H2,2-3H3/b18-13- |
| InChIKey | KGFHZVDUQGGXFH-AQTBWJFISA-N |
| XLogP | 5.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|