C11H10F4O — CID 177473841
1-methoxy-4-[(Z)-2,4,4,4-tetrafluorobut-1-enyl]benzene (PubChem CID 177473841) has the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. Its IUPAC name is 1-methoxy-4-[(Z)-2,4,4,4-tetrafluorobut-1-enyl]benzene.
| Compound Name | 1-methoxy-4-[(Z)-2,4,4,4-tetrafluorobut-1-enyl]benzene |
|---|---|
| PubChem CID | 177473841 |
| Molecular Formula | C11H10F4O |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-methoxy-4-[(Z)-2,4,4,4-tetrafluorobut-1-enyl]benzene |
| SMILES | COc1ccc(/C=C(\F)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F4O/c1-16-10-4-2-8(3-5-10)6-9(12)7-11(13,14)15/h2-6H,7H2,1H3/b9-6- |
| InChIKey | NFHNZRRUVYBBNX-TWGQIWQCSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |