C33H42N2O2 — CID 172640286
2-[4-[2-cyclopentyl-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 172640286) has the molecular formula C33H42N2O2 and a molecular weight of 498.71 g/mol. Its IUPAC name is 2-[4-[2-cyclopentyl-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[2-cyclopentyl-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 172640286 |
| Molecular Formula | C33H42N2O2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 2-[4-[2-cyclopentyl-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylethenyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc(C(=C(c2ccccc2)C2CCCC2)c2ccc(OCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H42N2O2/c1-34(2)22-24-36-30-18-14-28(15-19-30)33(29-16-20-31(21-17-29)37-25-23-35(3)4)32(27-12-8-9-13-27)26-10-6-5-7-11-26/h5-7,10-11,14-21,27H,8-9,12-13,22-25H2,1-4H3 |
| InChIKey | YJVMRPXHXZICOV-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|