C22H19N3O — CID 118887290
4-[(Z)-4-azido-1,2-diphenylbut-1-enyl]phenol (PubChem CID 118887290) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[(Z)-4-azido-1,2-diphenylbut-1-enyl]phenol.
| Compound Name | 4-[(Z)-4-azido-1,2-diphenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 118887290 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-[(Z)-4-azido-1,2-diphenylbut-1-enyl]phenol |
| SMILES | [N-]=[N+]=NCC/C(=C(\c1ccccc1)c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O/c23-25-24-16-15-21(17-7-3-1-4-8-17)22(18-9-5-2-6-10-18)19-11-13-20(26)14-12-19/h1-14,26H,15-16H2/b22-21- |
| InChIKey | UEYPDJFIPOAEQO-DQRAZIAOSA-N |
| XLogP | 6.05 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|