C30H38N2O2 — CID 100918693
4-[10-(2-aminoethylamino)-1-(4-hydroxyphenyl)-2-phenyldec-1-enyl]phenol (PubChem CID 100918693) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 4-[10-(2-aminoethylamino)-1-(4-hydroxyphenyl)-2-phenyldec-1-enyl]phenol.
| Compound Name | 4-[10-(2-aminoethylamino)-1-(4-hydroxyphenyl)-2-phenyldec-1-enyl]phenol |
|---|---|
| PubChem CID | 100918693 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 4-[10-(2-aminoethylamino)-1-(4-hydroxyphenyl)-2-phenyldec-1-enyl]phenol |
| SMILES | NCCNCCCCCCCCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H38N2O2/c31-21-23-32-22-9-4-2-1-3-8-12-29(24-10-6-5-7-11-24)30(25-13-17-27(33)18-14-25)26-15-19-28(34)20-16-26/h5-7,10-11,13-20,32-34H,1-4,8-9,12,21-23,31H2 |
| InChIKey | HENJTOQVYNGOFC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|