C22H17NO2 — CID 129137301
4,4-bis(4-hydroxyphenyl)-3-phenylbut-3-enenitrile (PubChem CID 129137301) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4,4-bis(4-hydroxyphenyl)-3-phenylbut-3-enenitrile.
| Compound Name | 4,4-bis(4-hydroxyphenyl)-3-phenylbut-3-enenitrile |
|---|---|
| PubChem CID | 129137301 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4,4-bis(4-hydroxyphenyl)-3-phenylbut-3-enenitrile |
| SMILES | N#CCC(=C(c1ccc(O)cc1)c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H17NO2/c23-15-14-21(16-4-2-1-3-5-16)22(17-6-10-19(24)11-7-17)18-8-12-20(25)13-9-18/h1-13,24-25H,14H2 |
| InChIKey | MFNUUSKORIZHNY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|