C26H25NO2 — CID 101266071
6,6-bis(4-methoxyphenyl)-5-phenylhex-5-enenitrile (PubChem CID 101266071) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 6,6-bis(4-methoxyphenyl)-5-phenylhex-5-enenitrile.
| Compound Name | 6,6-bis(4-methoxyphenyl)-5-phenylhex-5-enenitrile |
|---|---|
| PubChem CID | 101266071 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 6,6-bis(4-methoxyphenyl)-5-phenylhex-5-enenitrile |
| SMILES | COc1ccc(C(=C(CCCC#N)c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H25NO2/c1-28-23-15-11-21(12-16-23)26(22-13-17-24(29-2)18-14-22)25(10-6-7-19-27)20-8-4-3-5-9-20/h3-5,8-9,11-18H,6-7,10H2,1-2H3 |
| InChIKey | CUSAKSVKGQOXIZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|