C30H38Cl2N2O2 — CID 162672342
4-[(E)-5-hydroxy-2-phenyl-1-[4-(2-piperidin-1-ylethylamino)phenyl]pent-1-enyl]phenol;dihydrochloride (PubChem CID 162672342) has the molecular formula C30H38Cl2N2O2 and a molecular weight of 529.55 g/mol. Its IUPAC name is 4-[(E)-5-hydroxy-2-phenyl-1-[4-(2-piperidin-1-ylethylamino)phenyl]pent-1-enyl]phenol;dihydrochloride.
| Compound Name | 4-[(E)-5-hydroxy-2-phenyl-1-[4-(2-piperidin-1-ylethylamino)phenyl]pent-1-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 162672342 |
| Molecular Formula | C30H38Cl2N2O2 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 4-[(E)-5-hydroxy-2-phenyl-1-[4-(2-piperidin-1-ylethylamino)phenyl]pent-1-enyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.OCCC/C(=C(\c1ccc(O)cc1)c1ccc(NCCN2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H36N2O2.2ClH/c33-23-7-10-29(24-8-3-1-4-9-24)30(26-13-17-28(34)18-14-26)25-11-15-27(16-12-25)31-19-22-32-20-5-2-6-21-32;;/h1,3-4,8-9,11-18,31,33-34H,2,5-7,10,19-23H2;2*1H/b30-29+;; |
| InChIKey | SYISRFOCORFOJD-NFOZGECASA-N |
| XLogP | 6.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|