C27H30ClNO3 — CID 162664318
4-[(E)-5-hydroxy-1-(4-morpholin-4-ylphenyl)-2-phenylpent-1-enyl]phenol;hydrochloride (PubChem CID 162664318) has the molecular formula C27H30ClNO3 and a molecular weight of 451.99 g/mol. Its IUPAC name is 4-[(E)-5-hydroxy-1-(4-morpholin-4-ylphenyl)-2-phenylpent-1-enyl]phenol;hydrochloride.
| Compound Name | 4-[(E)-5-hydroxy-1-(4-morpholin-4-ylphenyl)-2-phenylpent-1-enyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 162664318 |
| Molecular Formula | C27H30ClNO3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 4-[(E)-5-hydroxy-1-(4-morpholin-4-ylphenyl)-2-phenylpent-1-enyl]phenol;hydrochloride |
| SMILES | Cl.OCCC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO3.ClH/c29-18-4-7-26(21-5-2-1-3-6-21)27(23-10-14-25(30)15-11-23)22-8-12-24(13-9-22)28-16-19-31-20-17-28;/h1-3,5-6,8-15,29-30H,4,7,16-20H2;1H/b27-26+; |
| InChIKey | RLTOTEOECPNTOL-JGUILPGDSA-N |
| XLogP | 5.38 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|