C29H34N2O — CID 176732330
5-(4-methylphenyl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-4-phenylpent-4-en-1-ol (PubChem CID 176732330) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is 5-(4-methylphenyl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-4-phenylpent-4-en-1-ol.
| Compound Name | 5-(4-methylphenyl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-4-phenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 176732330 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 5-(4-methylphenyl)-5-[4-(4-methylpiperazin-1-yl)phenyl]-4-phenylpent-4-en-1-ol |
| SMILES | Cc1ccc(C(=C(CCCO)c2ccccc2)c2ccc(N3CCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O/c1-23-10-12-25(13-11-23)29(28(9-6-22-32)24-7-4-3-5-8-24)26-14-16-27(17-15-26)31-20-18-30(2)19-21-31/h3-5,7-8,10-17,32H,6,9,18-22H2,1-2H3 |
| InChIKey | PZDWZAMMWRBRBP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|