C33H42N2O2 — CID 145430215
4-[(Z)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol (PubChem CID 145430215) has the molecular formula C33H42N2O2 and a molecular weight of 498.71 g/mol. Its IUPAC name is 4-[(Z)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol.
| Compound Name | 4-[(Z)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 145430215 |
| Molecular Formula | C33H42N2O2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 4-[(Z)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]cyclohexa-2,4-dien-1-ol |
| SMILES | OCCC/C(=C(\C1=CCC(O)C=C1)c1ccc(N2CCN(C3CCCCC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H42N2O2/c36-25-7-12-32(26-8-3-1-4-9-26)33(28-15-19-31(37)20-16-28)27-13-17-30(18-14-27)35-23-21-34(22-24-35)29-10-5-2-6-11-29/h1,3-4,8-9,13-19,29,31,36-37H,2,5-7,10-12,20-25H2/b33-32+ |
| InChIKey | SOMYPJSRXKVLTG-ULIFNZDWSA-N |
| XLogP | 6.07 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|