C28H37N3O — CID 167028412
(E)-5-(4-aminophenyl)-5-[4-(4-methylpiperazin-1-yl)cyclohexen-1-yl]-4-phenylpent-4-en-1-ol (PubChem CID 167028412) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is (E)-5-(4-aminophenyl)-5-[4-(4-methylpiperazin-1-yl)cyclohexen-1-yl]-4-phenylpent-4-en-1-ol.
| Compound Name | (E)-5-(4-aminophenyl)-5-[4-(4-methylpiperazin-1-yl)cyclohexen-1-yl]-4-phenylpent-4-en-1-ol |
|---|---|
| PubChem CID | 167028412 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (E)-5-(4-aminophenyl)-5-[4-(4-methylpiperazin-1-yl)cyclohexen-1-yl]-4-phenylpent-4-en-1-ol |
| SMILES | CN1CCN(C2CC=C(/C(=C(/CCCO)c3ccccc3)c3ccc(N)cc3)CC2)CC1 |
| InChI | InChI=1S/C28H37N3O/c1-30-17-19-31(20-18-30)26-15-11-24(12-16-26)28(23-9-13-25(29)14-10-23)27(8-5-21-32)22-6-3-2-4-7-22/h2-4,6-7,9-11,13-14,26,32H,5,8,12,15-21,29H2,1H3/b28-27- |
| InChIKey | PYXVDVXSAJDJRN-DQSJHHFOSA-N |
| XLogP | 4.68 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|