C33H42Cl2N2O2 — CID 155567147
4-[(E)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol;dihydrochloride (PubChem CID 155567147) has the molecular formula C33H42Cl2N2O2 and a molecular weight of 569.62 g/mol. Its IUPAC name is 4-[(E)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol;dihydrochloride.
| Compound Name | 4-[(E)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 155567147 |
| Molecular Formula | C33H42Cl2N2O2 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 4-[(E)-1-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-5-hydroxy-2-phenylpent-1-enyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.OCCC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCN(C3CCCCC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H40N2O2.2ClH/c36-25-7-12-32(26-8-3-1-4-9-26)33(28-15-19-31(37)20-16-28)27-13-17-30(18-14-27)35-23-21-34(22-24-35)29-10-5-2-6-11-29;;/h1,3-4,8-9,13-20,29,36-37H,2,5-7,10-12,21-25H2;2*1H/b33-32+;; |
| InChIKey | XAPXVYSMBUGLID-BZAYTVMESA-N |
| XLogP | 7.42 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|