C31H34FNO — CID 162672808
4-[(E)-1-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-fluoro-2-phenylpent-1-enyl]phenol (PubChem CID 162672808) has the molecular formula C31H34FNO and a molecular weight of 455.62 g/mol. Its IUPAC name is 4-[(E)-1-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-fluoro-2-phenylpent-1-enyl]phenol.
| Compound Name | 4-[(E)-1-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-fluoro-2-phenylpent-1-enyl]phenol |
|---|---|
| PubChem CID | 162672808 |
| Molecular Formula | C31H34FNO |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 4-[(E)-1-[4-(1-cyclopropylpiperidin-4-yl)phenyl]-5-fluoro-2-phenylpent-1-enyl]phenol |
| SMILES | Oc1ccc(/C(=C(\CCCF)c2ccccc2)c2ccc(C3CCN(C4CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H34FNO/c32-20-4-7-30(25-5-2-1-3-6-25)31(27-12-16-29(34)17-13-27)26-10-8-23(9-11-26)24-18-21-33(22-19-24)28-14-15-28/h1-3,5-6,8-13,16-17,24,28,34H,4,7,14-15,18-22H2/b31-30+ |
| InChIKey | LSXNUCOYUCKQNA-NVQSTNCTSA-N |
| XLogP | 7.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|