C30H34N2O3 — CID 155544192
4-[(E)-5-hydroxy-1-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2-phenylpent-1-enyl]phenol (PubChem CID 155544192) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-[(E)-5-hydroxy-1-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2-phenylpent-1-enyl]phenol.
| Compound Name | 4-[(E)-5-hydroxy-1-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2-phenylpent-1-enyl]phenol |
|---|---|
| PubChem CID | 155544192 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 4-[(E)-5-hydroxy-1-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2-phenylpent-1-enyl]phenol |
| SMILES | OCCC/C(=C(\c1ccc(O)cc1)c1ccc(N2CCN(C3COC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H34N2O3/c33-20-4-7-29(23-5-2-1-3-6-23)30(25-10-14-28(34)15-11-25)24-8-12-26(13-9-24)31-16-18-32(19-17-31)27-21-35-22-27/h1-3,5-6,8-15,27,33-34H,4,7,16-22H2/b30-29+ |
| InChIKey | HUJOCQVNYHHQBD-QVIHXGFCSA-N |
| XLogP | 4.64 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|