C33H45NO2 — CID 145430219
4-[(E)-1-[4-(azetidin-3-yl)phenyl]-6-hydroxy-2-phenylhex-1-enyl]phenol;butane;ethane (PubChem CID 145430219) has the molecular formula C33H45NO2 and a molecular weight of 487.73 g/mol. Its IUPAC name is 4-[(E)-1-[4-(azetidin-3-yl)phenyl]-6-hydroxy-2-phenylhex-1-enyl]phenol;butane;ethane.
| Compound Name | 4-[(E)-1-[4-(azetidin-3-yl)phenyl]-6-hydroxy-2-phenylhex-1-enyl]phenol;butane;ethane |
|---|---|
| PubChem CID | 145430219 |
| Molecular Formula | C33H45NO2 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | 4-[(E)-1-[4-(azetidin-3-yl)phenyl]-6-hydroxy-2-phenylhex-1-enyl]phenol;butane;ethane |
| SMILES | CC.CCCC.OCCCC/C(=C(\c1ccc(O)cc1)c1ccc(C2CNC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H29NO2.C4H10.C2H6/c29-17-5-4-8-26(21-6-2-1-3-7-21)27(23-13-15-25(30)16-14-23)22-11-9-20(10-12-22)24-18-28-19-24;1-3-4-2;1-2/h1-3,6-7,9-16,24,28-30H,4-5,8,17-19H2;3-4H2,1-2H3;1-2H3/b27-26+;; |
| InChIKey | IAPPJTHKSXLVHU-YOYNBWDYSA-N |
| XLogP | 8.03 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|