C39H50N2O4 — CID 138614564
[4-[(E)-5-(2,2-dimethylpropanoyloxy)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenylpent-1-enyl]phenyl] 2,2-dimethylbutanoate (PubChem CID 138614564) has the molecular formula C39H50N2O4 and a molecular weight of 610.84 g/mol. Its IUPAC name is [4-[(E)-5-(2,2-dimethylpropanoyloxy)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenylpent-1-enyl]phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[(E)-5-(2,2-dimethylpropanoyloxy)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenylpent-1-enyl]phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 138614564 |
| Molecular Formula | C39H50N2O4 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | [4-[(E)-5-(2,2-dimethylpropanoyloxy)-1-[4-(4-methylpiperazin-1-yl)phenyl]-2-phenylpent-1-enyl]phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(/C(=C(\CCCOC(=O)C(C)(C)C)c2ccccc2)c2ccc(N3CCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C39H50N2O4/c1-8-39(5,6)37(43)45-33-22-18-31(19-23-33)35(30-16-20-32(21-17-30)41-26-24-40(7)25-27-41)34(29-13-10-9-11-14-29)15-12-28-44-36(42)38(2,3)4/h9-11,13-14,16-23H,8,12,15,24-28H2,1-7H3/b35-34+ |
| InChIKey | QFNZRABLQJEFKR-XAHDOWKMSA-N |
| XLogP | 8.11 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|