C66H76N2O13 — CID 159912931
[4-(4-butoxybenzoyl)oxyphenyl] 4-nonylbenzoate;1-O-butyl 4-O-[4-[4-[4-(4-methylpiperazin-1-yl)phenoxy]carbonylphenoxy]carbonylphenyl] butanedioate (PubChem CID 159912931) has the molecular formula C66H76N2O13 and a molecular weight of 1105.33 g/mol. Its IUPAC name is [4-(4-butoxybenzoyl)oxyphenyl] 4-nonylbenzoate;1-O-butyl 4-O-[4-[4-[4-(4-methylpiperazin-1-yl)phenoxy]carbonylphenoxy]carbonylphenyl] butanedioate.
| Compound Name | [4-(4-butoxybenzoyl)oxyphenyl] 4-nonylbenzoate;1-O-butyl 4-O-[4-[4-[4-(4-methylpiperazin-1-yl)phenoxy]carbonylphenoxy]carbonylphenyl] butanedioate |
|---|---|
| PubChem CID | 159912931 |
| Molecular Formula | C66H76N2O13 |
| Molecular Weight | 1105.33 g/mol |
| Exact Mass | 1104.53 |
| IUPAC Name | [4-(4-butoxybenzoyl)oxyphenyl] 4-nonylbenzoate;1-O-butyl 4-O-[4-[4-[4-(4-methylpiperazin-1-yl)phenoxy]carbonylphenoxy]carbonylphenyl] butanedioate |
| SMILES | CCCCCCCCCc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCCC)cc3)cc2)cc1.CCCCOC(=O)CCC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(N4CCN(C)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H36N2O8.C33H40O5/c1-3-4-23-40-30(36)17-18-31(37)41-27-11-5-24(6-12-27)32(38)42-28-13-7-25(8-14-28)33(39)43-29-15-9-26(10-16-29)35-21-19-34(2)20-22-35;1-3-5-7-8-9-10-11-12-26-13-15-27(16-14-26)32(34)37-30-21-23-31(24-22-30)38-33(35)28-17-19-29(20-18-28)36-25-6-4-2/h5-16H,3-4,17-23H2,1-2H3;13-24H,3-12,25H2,1-2H3 |
| InChIKey | NXKHSEQSZZWNQE-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 173.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1105.33 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|