C33H44N2O3 — CID 145430089
[4-[(1E,3E,4Z)-3-ethylidene-2-(3-hydroxypropyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]hexa-1,4-dienyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 145430089) has the molecular formula C33H44N2O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is [4-[(1E,3E,4Z)-3-ethylidene-2-(3-hydroxypropyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]hexa-1,4-dienyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(1E,3E,4Z)-3-ethylidene-2-(3-hydroxypropyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]hexa-1,4-dienyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 145430089 |
| Molecular Formula | C33H44N2O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | [4-[(1E,3E,4Z)-3-ethylidene-2-(3-hydroxypropyl)-1-[4-(4-methylpiperazin-1-yl)phenyl]hexa-1,4-dienyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | C/C=C\C(=C/C)\C(CCCO)=C(\c1ccc(OC(=O)C(C)(C)C)cc1)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C33H44N2O3/c1-7-10-25(8-2)30(11-9-24-36)31(27-14-18-29(19-15-27)38-32(37)33(3,4)5)26-12-16-28(17-13-26)35-22-20-34(6)21-23-35/h7-8,10,12-19,36H,9,11,20-24H2,1-6H3/b10-7-,25-8+,31-30+ |
| InChIKey | WKPNQYSCRKMEIG-BYPFDOIBSA-N |
| XLogP | 6.49 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|