C30H40N2O2 — CID 138614640
3-[(1E,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]hepta-1,3,5-trienyl]phenol (PubChem CID 138614640) has the molecular formula C30H40N2O2 and a molecular weight of 460.66 g/mol. Its IUPAC name is 3-[(1E,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]hepta-1,3,5-trienyl]phenol.
| Compound Name | 3-[(1E,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]hepta-1,3,5-trienyl]phenol |
|---|---|
| PubChem CID | 138614640 |
| Molecular Formula | C30H40N2O2 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | 3-[(1E,3E,5Z)-2-(3-hydroxypropyl)-3-methyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]hepta-1,3,5-trienyl]phenol |
| SMILES | C/C=C\C=C(C)\C(CCCO)=C(/c1ccc(N2CCN(C(C)C)CC2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C30H40N2O2/c1-5-6-9-24(4)29(12-8-21-33)30(26-10-7-11-28(34)22-26)25-13-15-27(16-14-25)32-19-17-31(18-20-32)23(2)3/h5-7,9-11,13-16,22-23,33-34H,8,12,17-21H2,1-4H3/b6-5-,24-9+,30-29+ |
| InChIKey | ZCWXNVODFBMVNJ-IIPNALPBSA-N |
| XLogP | 6.02 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|