C30H34N2O — CID 166135511
3-[(E)-2-cyclopropyl-2-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]ethenyl]phenol (PubChem CID 166135511) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is 3-[(E)-2-cyclopropyl-2-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]ethenyl]phenol.
| Compound Name | 3-[(E)-2-cyclopropyl-2-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]ethenyl]phenol |
|---|---|
| PubChem CID | 166135511 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 3-[(E)-2-cyclopropyl-2-phenyl-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]ethenyl]phenol |
| SMILES | CC(C)N1CCN(c2ccc(/C(=C(\c3ccccc3)C3CC3)c3cccc(O)c3)cc2)CC1 |
| InChI | InChI=1S/C30H34N2O/c1-22(2)31-17-19-32(20-18-31)27-15-13-25(14-16-27)30(26-9-6-10-28(33)21-26)29(24-11-12-24)23-7-4-3-5-8-23/h3-10,13-16,21-22,24,33H,11-12,17-20H2,1-2H3/b30-29- |
| InChIKey | UOSZOXNYCXTPFZ-FLWNBWAVSA-N |
| XLogP | 6.29 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|