C32H40N2O2 — CID 167028410
3-[(1E,4Z,6Z)-1-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2-(3-hydroxypropyl)deca-1,4,6,9-tetraenyl]phenol (PubChem CID 167028410) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is 3-[(1E,4Z,6Z)-1-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2-(3-hydroxypropyl)deca-1,4,6,9-tetraenyl]phenol.
| Compound Name | 3-[(1E,4Z,6Z)-1-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2-(3-hydroxypropyl)deca-1,4,6,9-tetraenyl]phenol |
|---|---|
| PubChem CID | 167028410 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 3-[(1E,4Z,6Z)-1-[4-(4-cyclopropylpiperazin-1-yl)phenyl]-2-(3-hydroxypropyl)deca-1,4,6,9-tetraenyl]phenol |
| SMILES | C=CC/C=C\C=C/C/C(CCCO)=C(\c1ccc(N2CCN(C3CC3)CC2)cc1)c1cccc(O)c1 |
| InChI | InChI=1S/C32H40N2O2/c1-2-3-4-5-6-7-10-26(12-9-24-35)32(28-11-8-13-31(36)25-28)27-14-16-29(17-15-27)33-20-22-34(23-21-33)30-18-19-30/h2,4-8,11,13-17,25,30,35-36H,1,3,9-10,12,18-24H2/b5-4-,7-6-,32-26- |
| InChIKey | NNERJJNAJDSYAY-QKGVAPSBSA-N |
| XLogP | 6.33 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|