C30H51N3O15S3 — CID 146326430
3-[5-[[5-[6-(methylamino)hexanoylamino]-6-oxoheptyl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid (PubChem CID 146326430) has the molecular formula C30H51N3O15S3 and a molecular weight of 789.94 g/mol. Its IUPAC name is 3-[5-[[5-[6-(methylamino)hexanoylamino]-6-oxoheptyl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[5-[[5-[6-(methylamino)hexanoylamino]-6-oxoheptyl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 146326430 |
| Molecular Formula | C30H51N3O15S3 |
| Molecular Weight | 789.94 g/mol |
| Exact Mass | 789.25 |
| IUPAC Name | 3-[5-[[5-[6-(methylamino)hexanoylamino]-6-oxoheptyl]carbamoyl]-2,3-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
| SMILES | CNCCCCCC(=O)NC(CCCCNC(=O)c1cc(OCCCS(=O)(=O)O)c(OCCCS(=O)(=O)O)c(OCCCS(=O)(=O)O)c1)C(C)=O |
| InChI | InChI=1S/C30H51N3O15S3/c1-23(34)25(33-28(35)12-4-3-6-13-31-2)11-5-7-14-32-30(36)24-21-26(46-15-8-18-49(37,38)39)29(48-17-10-20-51(43,44)45)27(22-24)47-16-9-19-50(40,41)42/h21-22,25,31H,3-20H2,1-2H3,(H,32,36)(H,33,35)(H,37,38,39)(H,40,41,42)(H,43,44,45) |
| InChIKey | IFWGPNHLHUFHCS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 278.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.94 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|