C35H49N3O7 — CID 134461868
(3S)-3-(methylamino)-4-oxo-4-[5-[[3,4,5-tris(hex-5-ynoxy)benzoyl]amino]pentylamino]butanoic acid (PubChem CID 134461868) has the molecular formula C35H49N3O7 and a molecular weight of 623.79 g/mol. Its IUPAC name is (3S)-3-(methylamino)-4-oxo-4-[5-[[3,4,5-tris(hex-5-ynoxy)benzoyl]amino]pentylamino]butanoic acid.
| Compound Name | (3S)-3-(methylamino)-4-oxo-4-[5-[[3,4,5-tris(hex-5-ynoxy)benzoyl]amino]pentylamino]butanoic acid |
|---|---|
| PubChem CID | 134461868 |
| Molecular Formula | C35H49N3O7 |
| Molecular Weight | 623.79 g/mol |
| Exact Mass | 623.36 |
| IUPAC Name | (3S)-3-(methylamino)-4-oxo-4-[5-[[3,4,5-tris(hex-5-ynoxy)benzoyl]amino]pentylamino]butanoic acid |
| SMILES | C#CCCCCOc1cc(C(=O)NCCCCCNC(=O)[C@H](CC(=O)O)NC)cc(OCCCCC#C)c1OCCCCC#C |
| InChI | InChI=1S/C35H49N3O7/c1-5-8-11-17-22-43-30-25-28(26-31(44-23-18-12-9-6-2)33(30)45-24-19-13-10-7-3)34(41)37-20-15-14-16-21-38-35(42)29(36-4)27-32(39)40/h1-3,25-26,29,36H,8-24,27H2,4H3,(H,37,41)(H,38,42)(H,39,40)/t29-/m0/s1 |
| InChIKey | NUIMSIFAOWGCPY-LJAQVGFWSA-N |
| XLogP | 4.31 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|