C32H41N3O8 — CID 71653530
methyl 3,4,5-tris[3-(pent-4-ynoylamino)propoxy]benzoate (PubChem CID 71653530) has the molecular formula C32H41N3O8 and a molecular weight of 595.69 g/mol. Its IUPAC name is methyl 3,4,5-tris[3-(pent-4-ynoylamino)propoxy]benzoate.
| Compound Name | methyl 3,4,5-tris[3-(pent-4-ynoylamino)propoxy]benzoate |
|---|---|
| PubChem CID | 71653530 |
| Molecular Formula | C32H41N3O8 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | methyl 3,4,5-tris[3-(pent-4-ynoylamino)propoxy]benzoate |
| SMILES | C#CCCC(=O)NCCCOc1cc(C(=O)OC)cc(OCCCNC(=O)CCC#C)c1OCCCNC(=O)CCC#C |
| InChI | InChI=1S/C32H41N3O8/c1-5-8-14-28(36)33-17-11-20-41-26-23-25(32(39)40-4)24-27(42-21-12-18-34-29(37)15-9-6-2)31(26)43-22-13-19-35-30(38)16-10-7-3/h1-3,23-24H,8-22H2,4H3,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | MLKZCIGCJMYHEN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|