C19H25N3O4 — CID 102321393
4-(4-aminophenyl)-2,5-bis(3-aminopropoxy)benzoic acid (PubChem CID 102321393) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,5-bis(3-aminopropoxy)benzoic acid.
| Compound Name | 4-(4-aminophenyl)-2,5-bis(3-aminopropoxy)benzoic acid |
|---|---|
| PubChem CID | 102321393 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 4-(4-aminophenyl)-2,5-bis(3-aminopropoxy)benzoic acid |
| SMILES | NCCCOc1cc(-c2ccc(N)cc2)c(OCCCN)cc1C(=O)O |
| InChI | InChI=1S/C19H25N3O4/c20-7-1-9-25-17-12-16(19(23)24)18(26-10-2-8-21)11-15(17)13-3-5-14(22)6-4-13/h3-6,11-12H,1-2,7-10,20-22H2,(H,23,24) |
| InChIKey | KCVTUGGANRFBKA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|