C36H44Br2N2O8 — CID 159188403
4-[4-(4-aminophenyl)-2,5-bis(2-methoxyethoxy)phenyl]aniline;1,4-dibromo-2,5-bis(2-methoxyethoxy)benzene (PubChem CID 159188403) has the molecular formula C36H44Br2N2O8 and a molecular weight of 792.56 g/mol. Its IUPAC name is 4-[4-(4-aminophenyl)-2,5-bis(2-methoxyethoxy)phenyl]aniline;1,4-dibromo-2,5-bis(2-methoxyethoxy)benzene.
| Compound Name | 4-[4-(4-aminophenyl)-2,5-bis(2-methoxyethoxy)phenyl]aniline;1,4-dibromo-2,5-bis(2-methoxyethoxy)benzene |
|---|---|
| PubChem CID | 159188403 |
| Molecular Formula | C36H44Br2N2O8 |
| Molecular Weight | 792.56 g/mol |
| Exact Mass | 790.15 |
| IUPAC Name | 4-[4-(4-aminophenyl)-2,5-bis(2-methoxyethoxy)phenyl]aniline;1,4-dibromo-2,5-bis(2-methoxyethoxy)benzene |
| SMILES | COCCOc1cc(-c2ccc(N)cc2)c(OCCOC)cc1-c1ccc(N)cc1.COCCOc1cc(Br)c(OCCOC)cc1Br |
| InChI | InChI=1S/C24H28N2O4.C12H16Br2O4/c1-27-11-13-29-23-15-22(18-5-9-20(26)10-6-18)24(30-14-12-28-2)16-21(23)17-3-7-19(25)8-4-17;1-15-3-5-17-11-7-10(14)12(8-9(11)13)18-6-4-16-2/h3-10,15-16H,11-14,25-26H2,1-2H3;7-8H,3-6H2,1-2H3 |
| InChIKey | KNTWZMFGFUHOEP-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.56 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|