C27H25N3O3 — CID 108730468
N-[4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)-2-pyridinyl]acetamide (PubChem CID 108730468) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)-2-pyridinyl]acetamide.
| Compound Name | N-[4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 108730468 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(=O)N2CCC3(C=Cc4cc(-c5ccccc5)ccc4O3)CC2)ccn1 |
| InChI | InChI=1S/C27H25N3O3/c1-19(31)29-25-18-23(10-14-28-25)26(32)30-15-12-27(13-16-30)11-9-22-17-21(7-8-24(22)33-27)20-5-3-2-4-6-20/h2-11,14,17-18H,12-13,15-16H2,1H3,(H,28,29,31) |
| InChIKey | NCUKEDGIIHEGKK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |