C28H24ClNO2 — CID 108754055
(E)-3-(2-chlorophenyl)-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)prop-2-en-1-one (PubChem CID 108754055) has the molecular formula C28H24ClNO2 and a molecular weight of 441.96 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 108754055 |
| Molecular Formula | C28H24ClNO2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)N1CCC2(C=Cc3cc(-c4ccccc4)ccc3O2)CC1 |
| InChI | InChI=1S/C28H24ClNO2/c29-25-9-5-4-8-22(25)11-13-27(31)30-18-16-28(17-19-30)15-14-24-20-23(10-12-26(24)32-28)21-6-2-1-3-7-21/h1-15,20H,16-19H2/b13-11+ |
| InChIKey | TVYKBBWJRGQDBJ-ACCUITESSA-N |
| XLogP | 6.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|