About 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile
3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile (PubChem CID 108730474) has the molecular formula C27H22N2O2
and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile.
Molecular Properties
| Compound Name | 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile |
| PubChem CID | 108730474 |
| Molecular Formula | C27H22N2O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCC3(C=Cc4cc(-c5ccccc5)ccc4O3)CC2)c1 |
| InChI | InChI=1S/C27H22N2O2/c28-19-20-5-4-8-24(17-20)26(30)29-15-13-27(14-16-29)12-11-23-18-22(9-10-25(23)31-27)21-6-2-1-3-7-21/h1-12,17-18H,13-16H2 |
| InChIKey | JPNKHBROJNMCLE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile?
The IUPAC name of 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile (CID 108730474) is 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile.
What is the SMILES notation for 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile?
The canonical SMILES for 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile is N#Cc1cccc(C(=O)N2CCC3(C=Cc4cc(-c5ccccc5)ccc4O3)CC2)c1.
What is the InChIKey of 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile?
The InChIKey is JPNKHBROJNMCLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22N2O2/c28-19-20-5-4-8-24(17-20)26(30)29-15-13-27(14-16-29)12-11-23-18-22(9-10-25(23)31-27)21-6-2-1-3-7-21/h1-12,17-18H,13-16H2.
What are the key properties of 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile?
3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile has a molecular weight of 406.49 g/mol, XLogP of 5.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-carbonyl)benzonitrile is sourced from PubChem (CID 108730474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).