C25H24N2O5 — CID 108758078
2-[2-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 108758078) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[2-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108758078 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[2-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1C)OC1(CCN(C(=O)CN3C(=O)c4ccccc4C3=O)CC1)CC2=O |
| InChI | InChI=1S/C25H24N2O5/c1-15-7-8-19-20(28)13-25(32-22(19)16(15)2)9-11-26(12-10-25)21(29)14-27-23(30)17-5-3-4-6-18(17)24(27)31/h3-8H,9-14H2,1-2H3 |
| InChIKey | URJLGFOVSAJGQD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|