C29H33NO4 — CID 108734838
1-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione (PubChem CID 108734838) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione.
| Compound Name | 1-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 108734838 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 1-(7,8-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butane-1,4-dione |
| SMILES | Cc1ccc2c(c1C)OC1(CCN(C(=O)CCC(=O)c3ccc4c(c3)CCCC4)CC1)CC2=O |
| InChI | InChI=1S/C29H33NO4/c1-19-7-10-24-26(32)18-29(34-28(24)20(19)2)13-15-30(16-14-29)27(33)12-11-25(31)23-9-8-21-5-3-4-6-22(21)17-23/h7-10,17H,3-6,11-16,18H2,1-2H3 |
| InChIKey | BCTDNPYURHRGOP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |