C28H34N2O4 — CID 108734929
N-[6-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-6-oxohexyl]benzamide (PubChem CID 108734929) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[6-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-6-oxohexyl]benzamide.
| Compound Name | N-[6-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 108734929 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[6-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-6-oxohexyl]benzamide |
| SMILES | Cc1cc2c(cc1C)C(=O)CC1(CCN(C(=O)CCCCCNC(=O)c3ccccc3)CC1)O2 |
| InChI | InChI=1S/C28H34N2O4/c1-20-17-23-24(31)19-28(34-25(23)18-21(20)2)12-15-30(16-13-28)26(32)11-7-4-8-14-29-27(33)22-9-5-3-6-10-22/h3,5-6,9-10,17-18H,4,7-8,11-16,19H2,1-2H3,(H,29,33) |
| InChIKey | OSBUQSSZTVPGQC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|