C21H21Cl2NO4 — CID 108742978
4-(2,4-dichlorophenoxy)-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)butanamide (PubChem CID 108742978) has the molecular formula C21H21Cl2NO4 and a molecular weight of 422.31 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)butanamide |
|---|---|
| PubChem CID | 108742978 |
| Molecular Formula | C21H21Cl2NO4 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)butanamide |
| SMILES | CC1(C)CC(=O)c2cc(NC(=O)CCCOc3ccc(Cl)cc3Cl)ccc2O1 |
| InChI | InChI=1S/C21H21Cl2NO4/c1-21(2)12-17(25)15-11-14(6-8-18(15)28-21)24-20(26)4-3-9-27-19-7-5-13(22)10-16(19)23/h5-8,10-11H,3-4,9,12H2,1-2H3,(H,24,26) |
| InChIKey | BJEVSNRPVATHRD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|