C20H29Cl2N3O2 — CID 86958310
4-(2,4-dichlorophenoxy)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]butan-1-one (PubChem CID 86958310) has the molecular formula C20H29Cl2N3O2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(2,4-dichlorophenoxy)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 86958310 |
| Molecular Formula | C20H29Cl2N3O2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]butan-1-one |
| SMILES | CN1CCCC(N2CCN(C(=O)CCCOc3ccc(Cl)cc3Cl)CC2)C1 |
| InChI | InChI=1S/C20H29Cl2N3O2/c1-23-8-2-4-17(15-23)24-9-11-25(12-10-24)20(26)5-3-13-27-19-7-6-16(21)14-18(19)22/h6-7,14,17H,2-5,8-13,15H2,1H3 |
| InChIKey | HMNXABHVVKLLCL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|