C20H30BrN3O2 — CID 86958356
3-(3-bromo-4-methoxyphenyl)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]propan-1-one (PubChem CID 86958356) has the molecular formula C20H30BrN3O2 and a molecular weight of 424.38 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 86958356 |
| Molecular Formula | C20H30BrN3O2 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-1-[4-(1-methylpiperidin-3-yl)piperazin-1-yl]propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCN(C3CCCN(C)C3)CC2)cc1Br |
| InChI | InChI=1S/C20H30BrN3O2/c1-22-9-3-4-17(15-22)23-10-12-24(13-11-23)20(25)8-6-16-5-7-19(26-2)18(21)14-16/h5,7,14,17H,3-4,6,8-13,15H2,1-2H3 |
| InChIKey | SHJCTERTTFRDOT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |