C19H26BrNO4S — CID 90593814
3-(3-bromo-4-methoxyphenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)propan-1-one (PubChem CID 90593814) has the molecular formula C19H26BrNO4S and a molecular weight of 444.39 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)propan-1-one.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 90593814 |
| Molecular Formula | C19H26BrNO4S |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-1-(3-cyclohexylsulfonylazetidin-1-yl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CC(S(=O)(=O)C3CCCCC3)C2)cc1Br |
| InChI | InChI=1S/C19H26BrNO4S/c1-25-18-9-7-14(11-17(18)20)8-10-19(22)21-12-16(13-21)26(23,24)15-5-3-2-4-6-15/h7,9,11,15-16H,2-6,8,10,12-13H2,1H3 |
| InChIKey | PZPGGRGRHSEODD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |