C21H23BrFNO4S — CID 90589647
3-(3-bromo-4-methoxyphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one (PubChem CID 90589647) has the molecular formula C21H23BrFNO4S and a molecular weight of 484.39 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90589647 |
| Molecular Formula | C21H23BrFNO4S |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCC(S(=O)(=O)c3ccc(F)cc3)CC2)cc1Br |
| InChI | InChI=1S/C21H23BrFNO4S/c1-28-20-8-2-15(14-19(20)22)3-9-21(25)24-12-10-18(11-13-24)29(26,27)17-6-4-16(23)5-7-17/h2,4-8,14,18H,3,9-13H2,1H3 |
| InChIKey | DNAYFZSEFZPVBG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |