C21H23ClFNO3S — CID 90589673
3-(4-chloro-3-methylphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one (PubChem CID 90589673) has the molecular formula C21H23ClFNO3S and a molecular weight of 423.94 g/mol. Its IUPAC name is 3-(4-chloro-3-methylphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one.
| Compound Name | 3-(4-chloro-3-methylphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90589673 |
| Molecular Formula | C21H23ClFNO3S |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 3-(4-chloro-3-methylphenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)N2CCC(S(=O)(=O)c3ccc(F)cc3)CC2)ccc1Cl |
| InChI | InChI=1S/C21H23ClFNO3S/c1-15-14-16(2-8-20(15)22)3-9-21(25)24-12-10-19(11-13-24)28(26,27)18-6-4-17(23)5-7-18/h2,4-8,14,19H,3,9-13H2,1H3 |
| InChIKey | SOLAFFMAZYSRRR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |